C15H17NO3 — CID 68981311
2-spiro[chromene-2,4'-piperidine]-1'-ylacetic acid (PubChem CID 68981311) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-spiro[chromene-2,4'-piperidine]-1'-ylacetic acid.
| Compound Name | 2-spiro[chromene-2,4'-piperidine]-1'-ylacetic acid |
|---|---|
| PubChem CID | 68981311 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-spiro[chromene-2,4'-piperidine]-1'-ylacetic acid |
| SMILES | O=C(O)CN1CCC2(C=Cc3ccccc3O2)CC1 |
| InChI | InChI=1S/C15H17NO3/c17-14(18)11-16-9-7-15(8-10-16)6-5-12-3-1-2-4-13(12)19-15/h1-6H,7-11H2,(H,17,18) |
| InChIKey | PYHHTBDPMRZULJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |