C17H22N2O2 — CID 50965687
N-ethylspiro[azepane-4,2'-chromene]-1-carboxamide (PubChem CID 50965687) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-ethylspiro[azepane-4,2'-chromene]-1-carboxamide.
| Compound Name | N-ethylspiro[azepane-4,2'-chromene]-1-carboxamide |
|---|---|
| PubChem CID | 50965687 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-ethylspiro[azepane-4,2'-chromene]-1-carboxamide |
| SMILES | CCNC(=O)N1CCCC2(C=Cc3ccccc3O2)CC1 |
| InChI | InChI=1S/C17H22N2O2/c1-2-18-16(20)19-12-5-9-17(11-13-19)10-8-14-6-3-4-7-15(14)21-17/h3-4,6-8,10H,2,5,9,11-13H2,1H3,(H,18,20) |
| InChIKey | WDDSANFNHQKITG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |