C24H22N2O3 — CID 95228152
2-[(4S)-spiro[azepane-4,2'-chromene]-1-carbonyl]-1H-quinolin-4-one (PubChem CID 95228152) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-[(4S)-spiro[azepane-4,2'-chromene]-1-carbonyl]-1H-quinolin-4-one.
| Compound Name | 2-[(4S)-spiro[azepane-4,2'-chromene]-1-carbonyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 95228152 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-[(4S)-spiro[azepane-4,2'-chromene]-1-carbonyl]-1H-quinolin-4-one |
| SMILES | O=C(c1cc(=O)c2ccccc2[nH]1)N1CCC[C@@]2(C=Cc3ccccc3O2)CC1 |
| InChI | InChI=1S/C24H22N2O3/c27-21-16-20(25-19-8-3-2-7-18(19)21)23(28)26-14-5-11-24(13-15-26)12-10-17-6-1-4-9-22(17)29-24/h1-4,6-10,12,16H,5,11,13-15H2,(H,25,27)/t24-/m1/s1 |
| InChIKey | RHQOPKZKTMCVTB-XMMPIXPASA-N |
| XLogP | 4.00 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |