C15H15N3O3 — CID 62897216
2-(3-oxo-1,4-diazepane-1-carbonyl)-1H-quinolin-4-one (PubChem CID 62897216) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-(3-oxo-1,4-diazepane-1-carbonyl)-1H-quinolin-4-one.
| Compound Name | 2-(3-oxo-1,4-diazepane-1-carbonyl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 62897216 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-(3-oxo-1,4-diazepane-1-carbonyl)-1H-quinolin-4-one |
| SMILES | O=C1CN(C(=O)c2cc(=O)c3ccccc3[nH]2)CCCN1 |
| InChI | InChI=1S/C15H15N3O3/c19-13-8-12(17-11-5-2-1-4-10(11)13)15(21)18-7-3-6-16-14(20)9-18/h1-2,4-5,8H,3,6-7,9H2,(H,16,20)(H,17,19) |
| InChIKey | SZRJZMQFWFHJMV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |