C20H18ClN3O2 — CID 56914150
4-(5-chloro-3-phenyl-1H-indole-2-carbonyl)-1,4-diazepan-2-one (PubChem CID 56914150) has the molecular formula C20H18ClN3O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is 4-(5-chloro-3-phenyl-1H-indole-2-carbonyl)-1,4-diazepan-2-one.
| Compound Name | 4-(5-chloro-3-phenyl-1H-indole-2-carbonyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 56914150 |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 4-(5-chloro-3-phenyl-1H-indole-2-carbonyl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)c2[nH]c3ccc(Cl)cc3c2-c2ccccc2)CCCN1 |
| InChI | InChI=1S/C20H18ClN3O2/c21-14-7-8-16-15(11-14)18(13-5-2-1-3-6-13)19(23-16)20(26)24-10-4-9-22-17(25)12-24/h1-3,5-8,11,23H,4,9-10,12H2,(H,22,25) |
| InChIKey | KYWBDKUYLOUTHS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |