C24H19ClN2O — CID 91094574
5-chloro-N-(2,3-dihydro-1H-inden-2-yl)-3-phenyl-1H-indole-2-carboxamide (PubChem CID 91094574) has the molecular formula C24H19ClN2O and a molecular weight of 386.88 g/mol. Its IUPAC name is 5-chloro-N-(2,3-dihydro-1H-inden-2-yl)-3-phenyl-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-(2,3-dihydro-1H-inden-2-yl)-3-phenyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 91094574 |
| Molecular Formula | C24H19ClN2O |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 5-chloro-N-(2,3-dihydro-1H-inden-2-yl)-3-phenyl-1H-indole-2-carboxamide |
| SMILES | O=C(NC1Cc2ccccc2C1)c1[nH]c2ccc(Cl)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C24H19ClN2O/c25-18-10-11-21-20(14-18)22(15-6-2-1-3-7-15)23(27-21)24(28)26-19-12-16-8-4-5-9-17(16)13-19/h1-11,14,19,27H,12-13H2,(H,26,28) |
| InChIKey | PNUCPYRBSQJIPM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |