C22H16ClFN2O — CID 21014526
N-[(4-chlorophenyl)methyl]-5-fluoro-3-phenyl-1H-indole-2-carboxamide (PubChem CID 21014526) has the molecular formula C22H16ClFN2O and a molecular weight of 378.83 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-5-fluoro-3-phenyl-1H-indole-2-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-5-fluoro-3-phenyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 21014526 |
| Molecular Formula | C22H16ClFN2O |
| Molecular Weight | 378.83 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-5-fluoro-3-phenyl-1H-indole-2-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1[nH]c2ccc(F)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C22H16ClFN2O/c23-16-8-6-14(7-9-16)13-25-22(27)21-20(15-4-2-1-3-5-15)18-12-17(24)10-11-19(18)26-21/h1-12,26H,13H2,(H,25,27) |
| InChIKey | NJTZZXLTSUIFOF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.83 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |