C29H28FN3O2 — CID 175625980
N-[[(3aR,6R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,2]oxazol-6-yl]methyl]-5-fluoro-3-phenyl-1H-indole-2-carboxamide (PubChem CID 175625980) has the molecular formula C29H28FN3O2 and a molecular weight of 469.56 g/mol. Its IUPAC name is N-[[(3aR,6R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,2]oxazol-6-yl]methyl]-5-fluoro-3-phenyl-1H-indole-2-carboxamide.
| Compound Name | N-[[(3aR,6R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,2]oxazol-6-yl]methyl]-5-fluoro-3-phenyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 175625980 |
| Molecular Formula | C29H28FN3O2 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | N-[[(3aR,6R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,2]oxazol-6-yl]methyl]-5-fluoro-3-phenyl-1H-indole-2-carboxamide |
| SMILES | O=C(NC[C@H]1CC[C@@H]2CN(Cc3ccccc3)O[C@H]12)c1[nH]c2ccc(F)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C29H28FN3O2/c30-23-13-14-25-24(15-23)26(20-9-5-2-6-10-20)27(32-25)29(34)31-16-21-11-12-22-18-33(35-28(21)22)17-19-7-3-1-4-8-19/h1-10,13-15,21-22,28,32H,11-12,16-18H2,(H,31,34)/t21-,22-,28-/m1/s1 |
| InChIKey | NGRHPRGDTKMLHU-DQCZWYHMSA-N |
| XLogP | 5.55 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |