C23H18F4N2O2 — CID 142237632
N-[(2E)-2-ethenyl-4-(trifluoromethoxy)penta-2,4-dienyl]-5-fluoro-3-phenyl-1H-indole-2-carboxamide (PubChem CID 142237632) has the molecular formula C23H18F4N2O2 and a molecular weight of 430.40 g/mol. Its IUPAC name is N-[(2E)-2-ethenyl-4-(trifluoromethoxy)penta-2,4-dienyl]-5-fluoro-3-phenyl-1H-indole-2-carboxamide.
| Compound Name | N-[(2E)-2-ethenyl-4-(trifluoromethoxy)penta-2,4-dienyl]-5-fluoro-3-phenyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 142237632 |
| Molecular Formula | C23H18F4N2O2 |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-[(2E)-2-ethenyl-4-(trifluoromethoxy)penta-2,4-dienyl]-5-fluoro-3-phenyl-1H-indole-2-carboxamide |
| SMILES | C=C/C(=C\C(=C)OC(F)(F)F)CNC(=O)c1[nH]c2ccc(F)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C23H18F4N2O2/c1-3-15(11-14(2)31-23(25,26)27)13-28-22(30)21-20(16-7-5-4-6-8-16)18-12-17(24)9-10-19(18)29-21/h3-12,29H,1-2,13H2,(H,28,30)/b15-11+ |
| InChIKey | PWHIRQHXTKOKJC-RVDMUPIBSA-N |
| XLogP | 5.87 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|