C23H20ClN3O2 — CID 10644998
5-chloro-N'-[(2-hydroxy-5-methylphenyl)methyl]-3-phenyl-1H-indole-2-carbohydrazide (PubChem CID 10644998) has the molecular formula C23H20ClN3O2 and a molecular weight of 405.89 g/mol. Its IUPAC name is 5-chloro-N'-[(2-hydroxy-5-methylphenyl)methyl]-3-phenyl-1H-indole-2-carbohydrazide.
| Compound Name | 5-chloro-N'-[(2-hydroxy-5-methylphenyl)methyl]-3-phenyl-1H-indole-2-carbohydrazide |
|---|---|
| PubChem CID | 10644998 |
| Molecular Formula | C23H20ClN3O2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 5-chloro-N'-[(2-hydroxy-5-methylphenyl)methyl]-3-phenyl-1H-indole-2-carbohydrazide |
| SMILES | Cc1ccc(O)c(CNNC(=O)c2[nH]c3ccc(Cl)cc3c2-c2ccccc2)c1 |
| InChI | InChI=1S/C23H20ClN3O2/c1-14-7-10-20(28)16(11-14)13-25-27-23(29)22-21(15-5-3-2-4-6-15)18-12-17(24)8-9-19(18)26-22/h2-12,25-26,28H,13H2,1H3,(H,27,29) |
| InChIKey | ZJJOUBXXSDLMNA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|