C13H15ClN2O3 — CID 62898123
4-(4-chloro-2-methoxybenzoyl)-1,4-diazepan-2-one (PubChem CID 62898123) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is 4-(4-chloro-2-methoxybenzoyl)-1,4-diazepan-2-one.
| Compound Name | 4-(4-chloro-2-methoxybenzoyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 62898123 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-(4-chloro-2-methoxybenzoyl)-1,4-diazepan-2-one |
| SMILES | COc1cc(Cl)ccc1C(=O)N1CCCNC(=O)C1 |
| InChI | InChI=1S/C13H15ClN2O3/c1-19-11-7-9(14)3-4-10(11)13(18)16-6-2-5-15-12(17)8-16/h3-4,7H,2,5-6,8H2,1H3,(H,15,17) |
| InChIKey | MRNKCNNYHIPNTH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |