C12H15N3O3 — CID 113230147
4-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)-1,4-diazepan-2-one (PubChem CID 113230147) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)-1,4-diazepan-2-one.
| Compound Name | 4-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 113230147 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 4-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)-1,4-diazepan-2-one |
| SMILES | Cc1ccc(C(=O)N2CCCNC(=O)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H15N3O3/c1-8-3-4-9(11(17)14-8)12(18)15-6-2-5-13-10(16)7-15/h3-4H,2,5-7H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | SWOHTEOQBHPUSP-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |