C12H18ClN3O2 — CID 119381683
3-(3-aminopiperidine-1-carbonyl)-6-methyl-1H-pyridin-2-one;hydrochloride (PubChem CID 119381683) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is 3-(3-aminopiperidine-1-carbonyl)-6-methyl-1H-pyridin-2-one;hydrochloride.
| Compound Name | 3-(3-aminopiperidine-1-carbonyl)-6-methyl-1H-pyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119381683 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-(3-aminopiperidine-1-carbonyl)-6-methyl-1H-pyridin-2-one;hydrochloride |
| SMILES | Cc1ccc(C(=O)N2CCCC(N)C2)c(=O)[nH]1.Cl |
| InChI | InChI=1S/C12H17N3O2.ClH/c1-8-4-5-10(11(16)14-8)12(17)15-6-2-3-9(13)7-15;/h4-5,9H,2-3,6-7,13H2,1H3,(H,14,16);1H |
| InChIKey | ZRQGLZMQOTZWDY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |