C17H22N4O4 — CID 55867890
1-[4-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)piperazin-1-yl]-2-pyrrolidin-1-ylethane-1,2-dione (PubChem CID 55867890) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-[4-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)piperazin-1-yl]-2-pyrrolidin-1-ylethane-1,2-dione.
| Compound Name | 1-[4-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)piperazin-1-yl]-2-pyrrolidin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 55867890 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-[4-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)piperazin-1-yl]-2-pyrrolidin-1-ylethane-1,2-dione |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)C(=O)N3CCCC3)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H22N4O4/c1-12-4-5-13(14(22)18-12)15(23)20-8-10-21(11-9-20)17(25)16(24)19-6-2-3-7-19/h4-5H,2-3,6-11H2,1H3,(H,18,22) |
| InChIKey | CHGZSAHQBAFVHH-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|