C12H12Br2N2O2 — CID 114372478
4-(2,5-dibromobenzoyl)-1,4-diazepan-2-one (PubChem CID 114372478) has the molecular formula C12H12Br2N2O2 and a molecular weight of 376.05 g/mol. Its IUPAC name is 4-(2,5-dibromobenzoyl)-1,4-diazepan-2-one.
| Compound Name | 4-(2,5-dibromobenzoyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 114372478 |
| Molecular Formula | C12H12Br2N2O2 |
| Molecular Weight | 376.05 g/mol |
| Exact Mass | 373.93 |
| IUPAC Name | 4-(2,5-dibromobenzoyl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)c2cc(Br)ccc2Br)CCCN1 |
| InChI | InChI=1S/C12H12Br2N2O2/c13-8-2-3-10(14)9(6-8)12(18)16-5-1-4-15-11(17)7-16/h2-3,6H,1,4-5,7H2,(H,15,17) |
| InChIKey | PQSAWIZAUCPOOO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.05 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |