C12H14BrN3O2 — CID 63004090
1-(5-amino-2-bromobenzoyl)-1,4-diazepan-5-one (PubChem CID 63004090) has the molecular formula C12H14BrN3O2 and a molecular weight of 312.17 g/mol. Its IUPAC name is 1-(5-amino-2-bromobenzoyl)-1,4-diazepan-5-one.
| Compound Name | 1-(5-amino-2-bromobenzoyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 63004090 |
| Molecular Formula | C12H14BrN3O2 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 1-(5-amino-2-bromobenzoyl)-1,4-diazepan-5-one |
| SMILES | Nc1ccc(Br)c(C(=O)N2CCNC(=O)CC2)c1 |
| InChI | InChI=1S/C12H14BrN3O2/c13-10-2-1-8(14)7-9(10)12(18)16-5-3-11(17)15-4-6-16/h1-2,7H,3-6,14H2,(H,15,17) |
| InChIKey | NAUBQBNGCBYUFH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|