C12H13FN2O3 — CID 104929759
1-(2-fluoro-4-hydroxybenzoyl)-1,4-diazepan-5-one (PubChem CID 104929759) has the molecular formula C12H13FN2O3 and a molecular weight of 252.24 g/mol. Its IUPAC name is 1-(2-fluoro-4-hydroxybenzoyl)-1,4-diazepan-5-one.
| Compound Name | 1-(2-fluoro-4-hydroxybenzoyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 104929759 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1-(2-fluoro-4-hydroxybenzoyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)c2ccc(O)cc2F)CCN1 |
| InChI | InChI=1S/C12H13FN2O3/c13-10-7-8(16)1-2-9(10)12(18)15-5-3-11(17)14-4-6-15/h1-2,7,16H,3-6H2,(H,14,17) |
| InChIKey | GFSJEBRITNYYDD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |