C11H12FN3O2 — CID 114037699
1-(2-fluoropyridine-3-carbonyl)-1,4-diazepan-5-one (PubChem CID 114037699) has the molecular formula C11H12FN3O2 and a molecular weight of 237.23 g/mol. Its IUPAC name is 1-(2-fluoropyridine-3-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 1-(2-fluoropyridine-3-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 114037699 |
| Molecular Formula | C11H12FN3O2 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 1-(2-fluoropyridine-3-carbonyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)c2cccnc2F)CCN1 |
| InChI | InChI=1S/C11H12FN3O2/c12-10-8(2-1-4-14-10)11(17)15-6-3-9(16)13-5-7-15/h1-2,4H,3,5-7H2,(H,13,16) |
| InChIKey | AOVHFPJJFHFUKE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|