C12H12Cl2N2O2 — CID 55027869
1-(2,4-dichlorobenzoyl)-1,4-diazepan-5-one (PubChem CID 55027869) has the molecular formula C12H12Cl2N2O2 and a molecular weight of 287.15 g/mol. Its IUPAC name is 1-(2,4-dichlorobenzoyl)-1,4-diazepan-5-one.
| Compound Name | 1-(2,4-dichlorobenzoyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 55027869 |
| Molecular Formula | C12H12Cl2N2O2 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 1-(2,4-dichlorobenzoyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)c2ccc(Cl)cc2Cl)CCN1 |
| InChI | InChI=1S/C12H12Cl2N2O2/c13-8-1-2-9(10(14)7-8)12(18)16-5-3-11(17)15-4-6-16/h1-2,7H,3-6H2,(H,15,17) |
| InChIKey | MGZXLHPCXCKECK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |