C11H14ClN3O2 — CID 62046944
1-(4-chloro-1-methylpyrrole-2-carbonyl)-1,4-diazepan-5-one (PubChem CID 62046944) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrrole-2-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 1-(4-chloro-1-methylpyrrole-2-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 62046944 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 1-(4-chloro-1-methylpyrrole-2-carbonyl)-1,4-diazepan-5-one |
| SMILES | Cn1cc(Cl)cc1C(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C11H14ClN3O2/c1-14-7-8(12)6-9(14)11(17)15-4-2-10(16)13-3-5-15/h6-7H,2-5H2,1H3,(H,13,16) |
| InChIKey | YOHPKHMPUNWDBO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |