C10H14N4O2 — CID 62317121
1-(2-methylpyrazole-3-carbonyl)-1,4-diazepan-5-one (PubChem CID 62317121) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 1-(2-methylpyrazole-3-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 1-(2-methylpyrazole-3-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 62317121 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 1-(2-methylpyrazole-3-carbonyl)-1,4-diazepan-5-one |
| SMILES | Cn1nccc1C(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C10H14N4O2/c1-13-8(2-4-12-13)10(16)14-6-3-9(15)11-5-7-14/h2,4H,3,5-7H2,1H3,(H,11,15) |
| InChIKey | MHSSUMQBNNKQOE-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |