C11H11Cl2N3O2 — CID 106994002
4-(2,6-dichloropyridine-3-carbonyl)-1,4-diazepan-2-one (PubChem CID 106994002) has the molecular formula C11H11Cl2N3O2 and a molecular weight of 288.13 g/mol. Its IUPAC name is 4-(2,6-dichloropyridine-3-carbonyl)-1,4-diazepan-2-one.
| Compound Name | 4-(2,6-dichloropyridine-3-carbonyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 106994002 |
| Molecular Formula | C11H11Cl2N3O2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 4-(2,6-dichloropyridine-3-carbonyl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)c2ccc(Cl)nc2Cl)CCCN1 |
| InChI | InChI=1S/C11H11Cl2N3O2/c12-8-3-2-7(10(13)15-8)11(18)16-5-1-4-14-9(17)6-16/h2-3H,1,4-6H2,(H,14,17) |
| InChIKey | POKAJWFYIUHBBR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|