C15H14ClN3O2 — CID 65366073
4-(1-chloroisoquinoline-3-carbonyl)-1,4-diazepan-2-one (PubChem CID 65366073) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is 4-(1-chloroisoquinoline-3-carbonyl)-1,4-diazepan-2-one.
| Compound Name | 4-(1-chloroisoquinoline-3-carbonyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65366073 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 4-(1-chloroisoquinoline-3-carbonyl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)c2cc3ccccc3c(Cl)n2)CCCN1 |
| InChI | InChI=1S/C15H14ClN3O2/c16-14-11-5-2-1-4-10(11)8-12(18-14)15(21)19-7-3-6-17-13(20)9-19/h1-2,4-5,8H,3,6-7,9H2,(H,17,20) |
| InChIKey | VNWYHVDOBMAONQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|