C16H23N3O4 — CID 118770092
4-[2-(3-aminopropoxy)-3-methoxybenzoyl]-1,4-diazepan-2-one (PubChem CID 118770092) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[2-(3-aminopropoxy)-3-methoxybenzoyl]-1,4-diazepan-2-one.
| Compound Name | 4-[2-(3-aminopropoxy)-3-methoxybenzoyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 118770092 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-[2-(3-aminopropoxy)-3-methoxybenzoyl]-1,4-diazepan-2-one |
| SMILES | COc1cccc(C(=O)N2CCCNC(=O)C2)c1OCCCN |
| InChI | InChI=1S/C16H23N3O4/c1-22-13-6-2-5-12(15(13)23-10-3-7-17)16(21)19-9-4-8-18-14(20)11-19/h2,5-6H,3-4,7-11,17H2,1H3,(H,18,20) |
| InChIKey | DIOJRYVCRYRPSW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|