C20H24N2O4 — CID 125179048
[2-(3-aminopropoxy)-3-methoxyphenyl]-[(4S)-4-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 125179048) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is [2-(3-aminopropoxy)-3-methoxyphenyl]-[(4S)-4-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | [2-(3-aminopropoxy)-3-methoxyphenyl]-[(4S)-4-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 125179048 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [2-(3-aminopropoxy)-3-methoxyphenyl]-[(4S)-4-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | COc1cccc(C(=O)N2Cc3ccccc3[C@H](O)C2)c1OCCCN |
| InChI | InChI=1S/C20H24N2O4/c1-25-18-9-4-8-16(19(18)26-11-5-10-21)20(24)22-12-14-6-2-3-7-15(14)17(23)13-22/h2-4,6-9,17,23H,5,10-13,21H2,1H3/t17-/m1/s1 |
| InChIKey | VLWVNUAPVAIRJT-QGZVFWFLSA-N |
| XLogP | 2.11 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|