C18H29N3O3 — CID 126433817
[2-(3-aminopropoxy)-3-methoxyphenyl]-[(3S)-3-(dimethylamino)piperidin-1-yl]methanone (PubChem CID 126433817) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is [2-(3-aminopropoxy)-3-methoxyphenyl]-[(3S)-3-(dimethylamino)piperidin-1-yl]methanone.
| Compound Name | [2-(3-aminopropoxy)-3-methoxyphenyl]-[(3S)-3-(dimethylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 126433817 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | [2-(3-aminopropoxy)-3-methoxyphenyl]-[(3S)-3-(dimethylamino)piperidin-1-yl]methanone |
| SMILES | COc1cccc(C(=O)N2CCC[C@H](N(C)C)C2)c1OCCCN |
| InChI | InChI=1S/C18H29N3O3/c1-20(2)14-7-5-11-21(13-14)18(22)15-8-4-9-16(23-3)17(15)24-12-6-10-19/h4,8-9,14H,5-7,10-13,19H2,1-3H3/t14-/m0/s1 |
| InChIKey | NWDWNRQODBBHPW-AWEZNQCLSA-N |
| XLogP | 1.59 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|