C15H22N2O5S — CID 51079432
N-[1-(2,3-dimethoxybenzoyl)piperidin-3-yl]methanesulfonamide (PubChem CID 51079432) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-[1-(2,3-dimethoxybenzoyl)piperidin-3-yl]methanesulfonamide.
| Compound Name | N-[1-(2,3-dimethoxybenzoyl)piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 51079432 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[1-(2,3-dimethoxybenzoyl)piperidin-3-yl]methanesulfonamide |
| SMILES | COc1cccc(C(=O)N2CCCC(NS(C)(=O)=O)C2)c1OC |
| InChI | InChI=1S/C15H22N2O5S/c1-21-13-8-4-7-12(14(13)22-2)15(18)17-9-5-6-11(10-17)16-23(3,19)20/h4,7-8,11,16H,5-6,9-10H2,1-3H3 |
| InChIKey | PTIZCICCLQMEBF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |