C20H25N3O4 — CID 118787003
[4-(3-aminopropoxy)-3,5-dimethoxyphenyl]-(6-methyl-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)methanone (PubChem CID 118787003) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is [4-(3-aminopropoxy)-3,5-dimethoxyphenyl]-(6-methyl-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)methanone.
| Compound Name | [4-(3-aminopropoxy)-3,5-dimethoxyphenyl]-(6-methyl-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)methanone |
|---|---|
| PubChem CID | 118787003 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | [4-(3-aminopropoxy)-3,5-dimethoxyphenyl]-(6-methyl-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)methanone |
| SMILES | COc1cc(C(=O)N2Cc3cnc(C)cc3C2)cc(OC)c1OCCCN |
| InChI | InChI=1S/C20H25N3O4/c1-13-7-15-11-23(12-16(15)10-22-13)20(24)14-8-17(25-2)19(18(9-14)26-3)27-6-4-5-21/h7-10H,4-6,11-12,21H2,1-3H3 |
| InChIKey | UHEXZVXVHIIFJW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|