C16H24N2O5 — CID 125164781
4-(3-aminopropoxy)-3,5-dimethoxy-N-[(3R)-oxolan-3-yl]benzamide (PubChem CID 125164781) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-(3-aminopropoxy)-3,5-dimethoxy-N-[(3R)-oxolan-3-yl]benzamide.
| Compound Name | 4-(3-aminopropoxy)-3,5-dimethoxy-N-[(3R)-oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 125164781 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-(3-aminopropoxy)-3,5-dimethoxy-N-[(3R)-oxolan-3-yl]benzamide |
| SMILES | COc1cc(C(=O)N[C@@H]2CCOC2)cc(OC)c1OCCCN |
| InChI | InChI=1S/C16H24N2O5/c1-20-13-8-11(16(19)18-12-4-7-22-10-12)9-14(21-2)15(13)23-6-3-5-17/h8-9,12H,3-7,10,17H2,1-2H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | GGEKLPXOQLRHTO-GFCCVEGCSA-N |
| XLogP | 0.95 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|