C12H13ClFNO5S — CID 80716247
3-fluoro-2-methoxy-5-(oxolan-3-ylcarbamoyl)benzenesulfonyl chloride (PubChem CID 80716247) has the molecular formula C12H13ClFNO5S and a molecular weight of 337.76 g/mol. Its IUPAC name is 3-fluoro-2-methoxy-5-(oxolan-3-ylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 3-fluoro-2-methoxy-5-(oxolan-3-ylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 80716247 |
| Molecular Formula | C12H13ClFNO5S |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 3-fluoro-2-methoxy-5-(oxolan-3-ylcarbamoyl)benzenesulfonyl chloride |
| SMILES | COc1c(F)cc(C(=O)NC2CCOC2)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C12H13ClFNO5S/c1-19-11-9(14)4-7(5-10(11)21(13,17)18)12(16)15-8-2-3-20-6-8/h4-5,8H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | NHHOUKYDUOUMRP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |