C13H16ClNO4S — CID 80716250
2,3-dimethyl-5-(oxolan-3-ylcarbamoyl)benzenesulfonyl chloride (PubChem CID 80716250) has the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. Its IUPAC name is 2,3-dimethyl-5-(oxolan-3-ylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 2,3-dimethyl-5-(oxolan-3-ylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 80716250 |
| Molecular Formula | C13H16ClNO4S |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2,3-dimethyl-5-(oxolan-3-ylcarbamoyl)benzenesulfonyl chloride |
| SMILES | Cc1cc(C(=O)NC2CCOC2)cc(S(=O)(=O)Cl)c1C |
| InChI | InChI=1S/C13H16ClNO4S/c1-8-5-10(6-12(9(8)2)20(14,17)18)13(16)15-11-3-4-19-7-11/h5-6,11H,3-4,7H2,1-2H3,(H,15,16) |
| InChIKey | QFHSSUPWWNWYOH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |