C10H13N3O2 — CID 121352227
2-amino-N-[(3S)-oxolan-3-yl]pyridine-4-carboxamide (PubChem CID 121352227) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-amino-N-[(3S)-oxolan-3-yl]pyridine-4-carboxamide.
| Compound Name | 2-amino-N-[(3S)-oxolan-3-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 121352227 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-amino-N-[(3S)-oxolan-3-yl]pyridine-4-carboxamide |
| SMILES | Nc1cc(C(=O)N[C@H]2CCOC2)ccn1 |
| InChI | InChI=1S/C10H13N3O2/c11-9-5-7(1-3-12-9)10(14)13-8-2-4-15-6-8/h1,3,5,8H,2,4,6H2,(H2,11,12)(H,13,14)/t8-/m0/s1 |
| InChIKey | WMFRWNUYIVUOCU-QMMMGPOBSA-N |
| XLogP | 0.18 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |