C13H18N2O4 — CID 80716754
2-amino-4,5-dimethoxy-N-(oxolan-3-yl)benzamide (PubChem CID 80716754) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-amino-4,5-dimethoxy-N-(oxolan-3-yl)benzamide.
| Compound Name | 2-amino-4,5-dimethoxy-N-(oxolan-3-yl)benzamide |
|---|---|
| PubChem CID | 80716754 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-amino-4,5-dimethoxy-N-(oxolan-3-yl)benzamide |
| SMILES | COc1cc(N)c(C(=O)NC2CCOC2)cc1OC |
| InChI | InChI=1S/C13H18N2O4/c1-17-11-5-9(10(14)6-12(11)18-2)13(16)15-8-3-4-19-7-8/h5-6,8H,3-4,7,14H2,1-2H3,(H,15,16) |
| InChIKey | XMLMEZZNFRKTML-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|