C13H19N3O4 — CID 83012420
2-amino-4,5-dimethoxy-N-morpholin-4-ylbenzamide (PubChem CID 83012420) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-amino-4,5-dimethoxy-N-morpholin-4-ylbenzamide.
| Compound Name | 2-amino-4,5-dimethoxy-N-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 83012420 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-amino-4,5-dimethoxy-N-morpholin-4-ylbenzamide |
| SMILES | COc1cc(N)c(C(=O)NN2CCOCC2)cc1OC |
| InChI | InChI=1S/C13H19N3O4/c1-18-11-7-9(10(14)8-12(11)19-2)13(17)15-16-3-5-20-6-4-16/h7-8H,3-6,14H2,1-2H3,(H,15,17) |
| InChIKey | HKRZAFUABJSTGS-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|