C14H20N2O5 — CID 106099011
2-amino-N-[(3-hydroxyoxolan-3-yl)methyl]-4,5-dimethoxybenzamide (PubChem CID 106099011) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-amino-N-[(3-hydroxyoxolan-3-yl)methyl]-4,5-dimethoxybenzamide.
| Compound Name | 2-amino-N-[(3-hydroxyoxolan-3-yl)methyl]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 106099011 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-amino-N-[(3-hydroxyoxolan-3-yl)methyl]-4,5-dimethoxybenzamide |
| SMILES | COc1cc(N)c(C(=O)NCC2(O)CCOC2)cc1OC |
| InChI | InChI=1S/C14H20N2O5/c1-19-11-5-9(10(15)6-12(11)20-2)13(17)16-7-14(18)3-4-21-8-14/h5-6,18H,3-4,7-8,15H2,1-2H3,(H,16,17) |
| InChIKey | HVCDSAJOAZPCPJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|