C12H16N2O4 — CID 113337975
N-[(3-hydroxyoxolan-3-yl)methyl]-2-methoxypyridine-3-carboxamide (PubChem CID 113337975) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-[(3-hydroxyoxolan-3-yl)methyl]-2-methoxypyridine-3-carboxamide.
| Compound Name | N-[(3-hydroxyoxolan-3-yl)methyl]-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 113337975 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-[(3-hydroxyoxolan-3-yl)methyl]-2-methoxypyridine-3-carboxamide |
| SMILES | COc1ncccc1C(=O)NCC1(O)CCOC1 |
| InChI | InChI=1S/C12H16N2O4/c1-17-11-9(3-2-5-13-11)10(15)14-7-12(16)4-6-18-8-12/h2-3,5,16H,4,6-8H2,1H3,(H,14,15) |
| InChIKey | DDCLOODEYCLMOM-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |