C15H19NO4 — CID 103849206
N-[(3-hydroxyoxolan-3-yl)methyl]-2-prop-2-enoxybenzamide (PubChem CID 103849206) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-[(3-hydroxyoxolan-3-yl)methyl]-2-prop-2-enoxybenzamide.
| Compound Name | N-[(3-hydroxyoxolan-3-yl)methyl]-2-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 103849206 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-[(3-hydroxyoxolan-3-yl)methyl]-2-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccccc1C(=O)NCC1(O)CCOC1 |
| InChI | InChI=1S/C15H19NO4/c1-2-8-20-13-6-4-3-5-12(13)14(17)16-10-15(18)7-9-19-11-15/h2-6,18H,1,7-11H2,(H,16,17) |
| InChIKey | OXAIFMJKKJTKNM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|