C19H27NO4 — CID 126836030
N-[2-(3-hydroxyoxan-3-yl)-2-methylpropyl]-2-prop-2-enoxybenzamide (PubChem CID 126836030) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is N-[2-(3-hydroxyoxan-3-yl)-2-methylpropyl]-2-prop-2-enoxybenzamide.
| Compound Name | N-[2-(3-hydroxyoxan-3-yl)-2-methylpropyl]-2-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 126836030 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | N-[2-(3-hydroxyoxan-3-yl)-2-methylpropyl]-2-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccccc1C(=O)NCC(C)(C)C1(O)CCCOC1 |
| InChI | InChI=1S/C19H27NO4/c1-4-11-24-16-9-6-5-8-15(16)17(21)20-13-18(2,3)19(22)10-7-12-23-14-19/h4-6,8-9,22H,1,7,10-14H2,2-3H3,(H,20,21) |
| InChIKey | POXSVCUAUREGMY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|