C9H12N2O4 — CID 11535831
2-amino-N-hydroxy-4,5-dimethoxybenzamide (PubChem CID 11535831) has the molecular formula C9H12N2O4 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-amino-N-hydroxy-4,5-dimethoxybenzamide.
| Compound Name | 2-amino-N-hydroxy-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 11535831 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-amino-N-hydroxy-4,5-dimethoxybenzamide |
| SMILES | COc1cc(N)c(C(=O)NO)cc1OC |
| InChI | InChI=1S/C9H12N2O4/c1-14-7-3-5(9(12)11-13)6(10)4-8(7)15-2/h3-4,13H,10H2,1-2H3,(H,11,12) |
| InChIKey | CKQQZJYIPVAYOO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|