C17H20N2O3 — CID 43825333
2-amino-N-(3,5-dimethylphenyl)-4,5-dimethoxybenzamide (PubChem CID 43825333) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-amino-N-(3,5-dimethylphenyl)-4,5-dimethoxybenzamide.
| Compound Name | 2-amino-N-(3,5-dimethylphenyl)-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 43825333 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-amino-N-(3,5-dimethylphenyl)-4,5-dimethoxybenzamide |
| SMILES | COc1cc(N)c(C(=O)Nc2cc(C)cc(C)c2)cc1OC |
| InChI | InChI=1S/C17H20N2O3/c1-10-5-11(2)7-12(6-10)19-17(20)13-8-15(21-3)16(22-4)9-14(13)18/h5-9H,18H2,1-4H3,(H,19,20) |
| InChIKey | APOJIIOJEVDTLB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|