C15H16N2O4 — CID 61168074
2-amino-N-(3-hydroxyphenyl)-4,5-dimethoxybenzamide (PubChem CID 61168074) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-amino-N-(3-hydroxyphenyl)-4,5-dimethoxybenzamide.
| Compound Name | 2-amino-N-(3-hydroxyphenyl)-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 61168074 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-amino-N-(3-hydroxyphenyl)-4,5-dimethoxybenzamide |
| SMILES | COc1cc(N)c(C(=O)Nc2cccc(O)c2)cc1OC |
| InChI | InChI=1S/C15H16N2O4/c1-20-13-7-11(12(16)8-14(13)21-2)15(19)17-9-4-3-5-10(18)6-9/h3-8,18H,16H2,1-2H3,(H,17,19) |
| InChIKey | NCCWBZAJHJOPFD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|