C18H20BrNO4 — CID 19171551
2-bromo-N-(3,5-dimethylphenyl)-3,4,5-trimethoxybenzamide (PubChem CID 19171551) has the molecular formula C18H20BrNO4 and a molecular weight of 394.27 g/mol. Its IUPAC name is 2-bromo-N-(3,5-dimethylphenyl)-3,4,5-trimethoxybenzamide.
| Compound Name | 2-bromo-N-(3,5-dimethylphenyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 19171551 |
| Molecular Formula | C18H20BrNO4 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 2-bromo-N-(3,5-dimethylphenyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2cc(C)cc(C)c2)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C18H20BrNO4/c1-10-6-11(2)8-12(7-10)20-18(21)13-9-14(22-3)16(23-4)17(24-5)15(13)19/h6-9H,1-5H3,(H,20,21) |
| InChIKey | FWOWHXQLQPZOIC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |