C15H21BrN2O4 — CID 127217560
2-bromo-3,4,5-trimethoxy-N-piperidin-4-ylbenzamide (PubChem CID 127217560) has the molecular formula C15H21BrN2O4 and a molecular weight of 373.25 g/mol. Its IUPAC name is 2-bromo-3,4,5-trimethoxy-N-piperidin-4-ylbenzamide.
| Compound Name | 2-bromo-3,4,5-trimethoxy-N-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 127217560 |
| Molecular Formula | C15H21BrN2O4 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-bromo-3,4,5-trimethoxy-N-piperidin-4-ylbenzamide |
| SMILES | COc1cc(C(=O)NC2CCNCC2)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C15H21BrN2O4/c1-20-11-8-10(12(16)14(22-3)13(11)21-2)15(19)18-9-4-6-17-7-5-9/h8-9,17H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | XOKKARBKZFHYGO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |