C15H22N2O4 — CID 104645571
2,3,4-trimethoxy-N-[(3R)-piperidin-3-yl]benzamide (PubChem CID 104645571) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2,3,4-trimethoxy-N-[(3R)-piperidin-3-yl]benzamide.
| Compound Name | 2,3,4-trimethoxy-N-[(3R)-piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 104645571 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2,3,4-trimethoxy-N-[(3R)-piperidin-3-yl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2CCCNC2)c(OC)c1OC |
| InChI | InChI=1S/C15H22N2O4/c1-19-12-7-6-11(13(20-2)14(12)21-3)15(18)17-10-5-4-8-16-9-10/h6-7,10,16H,4-5,8-9H2,1-3H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | KFDOVDGCXWAJGC-SNVBAGLBSA-N |
| XLogP | 1.19 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |