C18H27NO4 — CID 70348568
2-piperidin-3-yl-1-(2,3,4-trimethoxyphenyl)butan-1-one (PubChem CID 70348568) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-piperidin-3-yl-1-(2,3,4-trimethoxyphenyl)butan-1-one.
| Compound Name | 2-piperidin-3-yl-1-(2,3,4-trimethoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 70348568 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-piperidin-3-yl-1-(2,3,4-trimethoxyphenyl)butan-1-one |
| SMILES | CCC(C(=O)c1ccc(OC)c(OC)c1OC)C1CCCNC1 |
| InChI | InChI=1S/C18H27NO4/c1-5-13(12-7-6-10-19-11-12)16(20)14-8-9-15(21-2)18(23-4)17(14)22-3/h8-9,12-13,19H,5-7,10-11H2,1-4H3 |
| InChIKey | GGGSLNQBNCUCLL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |