C11H14O6 — CID 173266032
methyl 2,3,4-trimethoxybenzenecarboperoxoate (PubChem CID 173266032) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is methyl 2,3,4-trimethoxybenzenecarboperoxoate.
| Compound Name | methyl 2,3,4-trimethoxybenzenecarboperoxoate |
|---|---|
| PubChem CID | 173266032 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methyl 2,3,4-trimethoxybenzenecarboperoxoate |
| SMILES | COOC(=O)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C11H14O6/c1-13-8-6-5-7(11(12)17-16-4)9(14-2)10(8)15-3/h5-6H,1-4H3 |
| InChIKey | RPRRTSWHJSTBOC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|