C17H17FO5 — CID 75451380
(2-fluoro-3-methylphenyl) 2,3,4-trimethoxybenzoate (PubChem CID 75451380) has the molecular formula C17H17FO5 and a molecular weight of 320.32 g/mol. Its IUPAC name is (2-fluoro-3-methylphenyl) 2,3,4-trimethoxybenzoate.
| Compound Name | (2-fluoro-3-methylphenyl) 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 75451380 |
| Molecular Formula | C17H17FO5 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (2-fluoro-3-methylphenyl) 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2cccc(C)c2F)c(OC)c1OC |
| InChI | InChI=1S/C17H17FO5/c1-10-6-5-7-12(14(10)18)23-17(19)11-8-9-13(20-2)16(22-4)15(11)21-3/h5-9H,1-4H3 |
| InChIKey | MDKRUCAATQZTHT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|