C15H7F5O5 — CID 162703095
2-methoxy-3-(2,3,4,5,6-pentafluorophenoxy)carbonylbenzoic acid (PubChem CID 162703095) has the molecular formula C15H7F5O5 and a molecular weight of 362.21 g/mol. Its IUPAC name is 2-methoxy-3-(2,3,4,5,6-pentafluorophenoxy)carbonylbenzoic acid.
| Compound Name | 2-methoxy-3-(2,3,4,5,6-pentafluorophenoxy)carbonylbenzoic acid |
|---|---|
| PubChem CID | 162703095 |
| Molecular Formula | C15H7F5O5 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 2-methoxy-3-(2,3,4,5,6-pentafluorophenoxy)carbonylbenzoic acid |
| SMILES | COc1c(C(=O)O)cccc1C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H7F5O5/c1-24-12-5(14(21)22)3-2-4-6(12)15(23)25-13-10(19)8(17)7(16)9(18)11(13)20/h2-4H,1H3,(H,21,22) |
| InChIKey | HPVIWZXXCAXJEQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|