C17H18N2O5 — CID 19290138
[(Z)-[amino(phenyl)methylidene]amino] 2,3,4-trimethoxybenzoate (PubChem CID 19290138) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is [(Z)-[amino(phenyl)methylidene]amino] 2,3,4-trimethoxybenzoate.
| Compound Name | [(Z)-[amino(phenyl)methylidene]amino] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 19290138 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | [(Z)-[amino(phenyl)methylidene]amino] 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)O/N=C(\N)c2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C17H18N2O5/c1-21-13-10-9-12(14(22-2)15(13)23-3)17(20)24-19-16(18)11-7-5-4-6-8-11/h4-10H,1-3H3,(H2,18,19) |
| InChIKey | UDPPMHGVGUGQCX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|