C14H20O7 — CID 173266543
1-methoxypropan-2-yl 2,3,4-trimethoxybenzenecarboperoxoate (PubChem CID 173266543) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 2,3,4-trimethoxybenzenecarboperoxoate.
| Compound Name | 1-methoxypropan-2-yl 2,3,4-trimethoxybenzenecarboperoxoate |
|---|---|
| PubChem CID | 173266543 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-methoxypropan-2-yl 2,3,4-trimethoxybenzenecarboperoxoate |
| SMILES | COCC(C)OOC(=O)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C14H20O7/c1-9(8-16-2)20-21-14(15)10-6-7-11(17-3)13(19-5)12(10)18-4/h6-7,9H,8H2,1-5H3 |
| InChIKey | PAKZWVKQTBHWAC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|